C9H11NO2 — CID 130707048
5-[(2R)-azetidin-2-yl]benzene-1,3-diol (PubChem CID 130707048) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is 5-[(2R)-azetidin-2-yl]benzene-1,3-diol.
| Compound Name | 5-[(2R)-azetidin-2-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 130707048 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 5-[(2R)-azetidin-2-yl]benzene-1,3-diol |
| SMILES | Oc1cc(O)cc([C@H]2CCN2)c1 |
| InChI | InChI=1S/C9H11NO2/c11-7-3-6(4-8(12)5-7)9-1-2-10-9/h3-5,9-12H,1-2H2/t9-/m1/s1 |
| InChIKey | MGKODYMPGUPGDS-SECBINFHSA-N |
| XLogP | 1.13 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |