C12H18ClNO — CID 171196939
(2S)-2-(4-methoxy-3,5-dimethylphenyl)azetidine;hydrochloride (PubChem CID 171196939) has the molecular formula C12H18ClNO and a molecular weight of 227.73 g/mol. Its IUPAC name is (2S)-2-(4-methoxy-3,5-dimethylphenyl)azetidine;hydrochloride.
| Compound Name | (2S)-2-(4-methoxy-3,5-dimethylphenyl)azetidine;hydrochloride |
|---|---|
| PubChem CID | 171196939 |
| Molecular Formula | C12H18ClNO |
| Molecular Weight | 227.73 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | (2S)-2-(4-methoxy-3,5-dimethylphenyl)azetidine;hydrochloride |
| SMILES | COc1c(C)cc([C@@H]2CCN2)cc1C.Cl |
| InChI | InChI=1S/C12H17NO.ClH/c1-8-6-10(11-4-5-13-11)7-9(2)12(8)14-3;/h6-7,11,13H,4-5H2,1-3H3;1H/t11-;/m0./s1 |
| InChIKey | NNIYDWZFXNMSEL-MERQFXBCSA-N |
| XLogP | 2.77 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.73 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |