C13H20ClNO — CID 169498562
3-(4-methoxy-3,5-dimethylphenyl)pyrrolidine;hydrochloride (PubChem CID 169498562) has the molecular formula C13H20ClNO and a molecular weight of 241.76 g/mol. Its IUPAC name is 3-(4-methoxy-3,5-dimethylphenyl)pyrrolidine;hydrochloride.
| Compound Name | 3-(4-methoxy-3,5-dimethylphenyl)pyrrolidine;hydrochloride |
|---|---|
| PubChem CID | 169498562 |
| Molecular Formula | C13H20ClNO |
| Molecular Weight | 241.76 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 3-(4-methoxy-3,5-dimethylphenyl)pyrrolidine;hydrochloride |
| SMILES | COc1c(C)cc(C2CCNC2)cc1C.Cl |
| InChI | InChI=1S/C13H19NO.ClH/c1-9-6-12(11-4-5-14-8-11)7-10(2)13(9)15-3;/h6-7,11,14H,4-5,8H2,1-3H3;1H |
| InChIKey | VDTJOMCVVCIQPY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.76 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |