C14H22N2O — CID 115118890
N-[(4-methoxy-3,5-dimethylphenyl)methyl]pyrrolidin-3-amine (PubChem CID 115118890) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is N-[(4-methoxy-3,5-dimethylphenyl)methyl]pyrrolidin-3-amine.
| Compound Name | N-[(4-methoxy-3,5-dimethylphenyl)methyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 115118890 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | N-[(4-methoxy-3,5-dimethylphenyl)methyl]pyrrolidin-3-amine |
| SMILES | COc1c(C)cc(CNC2CCNC2)cc1C |
| InChI | InChI=1S/C14H22N2O/c1-10-6-12(7-11(2)14(10)17-3)8-16-13-4-5-15-9-13/h6-7,13,15-16H,4-5,8-9H2,1-3H3 |
| InChIKey | YGDOCWWSAWAKTN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |