C13H18BrNO — CID 117457157
3-(4-bromo-2-methoxy-3,5-dimethylphenyl)pyrrolidine (PubChem CID 117457157) has the molecular formula C13H18BrNO and a molecular weight of 284.20 g/mol. Its IUPAC name is 3-(4-bromo-2-methoxy-3,5-dimethylphenyl)pyrrolidine.
| Compound Name | 3-(4-bromo-2-methoxy-3,5-dimethylphenyl)pyrrolidine |
|---|---|
| PubChem CID | 117457157 |
| Molecular Formula | C13H18BrNO |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 3-(4-bromo-2-methoxy-3,5-dimethylphenyl)pyrrolidine |
| SMILES | COc1c(C2CCNC2)cc(C)c(Br)c1C |
| InChI | InChI=1S/C13H18BrNO/c1-8-6-11(10-4-5-15-7-10)13(16-3)9(2)12(8)14/h6,10,15H,4-5,7H2,1-3H3 |
| InChIKey | GIPUAMXMMLMWQO-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |