C17H27NO — CID 171196611
4-[(2S)-azetidin-2-yl]-2,6-ditert-butylphenol (PubChem CID 171196611) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is 4-[(2S)-azetidin-2-yl]-2,6-ditert-butylphenol.
| Compound Name | 4-[(2S)-azetidin-2-yl]-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 171196611 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | 4-[(2S)-azetidin-2-yl]-2,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc([C@@H]2CCN2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C17H27NO/c1-16(2,3)12-9-11(14-7-8-18-14)10-13(15(12)19)17(4,5)6/h9-10,14,18-19H,7-8H2,1-6H3/t14-/m0/s1 |
| InChIKey | GYTCPRBCCFKNGZ-AWEZNQCLSA-N |
| XLogP | 4.02 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |