C25H30N2O — CID 2864280
2,6-ditert-butyl-4-(2,3-dihydro-1H-perimidin-2-yl)phenol (PubChem CID 2864280) has the molecular formula C25H30N2O and a molecular weight of 374.53 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-(2,3-dihydro-1H-perimidin-2-yl)phenol.
| Compound Name | 2,6-ditert-butyl-4-(2,3-dihydro-1H-perimidin-2-yl)phenol |
|---|---|
| PubChem CID | 2864280 |
| Molecular Formula | C25H30N2O |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | 2,6-ditert-butyl-4-(2,3-dihydro-1H-perimidin-2-yl)phenol |
| SMILES | CC(C)(C)c1cc(C2Nc3cccc4cccc(c34)N2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C25H30N2O/c1-24(2,3)17-13-16(14-18(22(17)28)25(4,5)6)23-26-19-11-7-9-15-10-8-12-20(27-23)21(15)19/h7-14,23,26-28H,1-6H3 |
| InChIKey | WBSRWPYIVUJCCR-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'naphth_amino_B(25)', 'substructure': 'N/A'} |
|---|