About 2,6-ditert-butyl-4-(2,6-dimethylphenyl)phenol
2,6-ditert-butyl-4-(2,6-dimethylphenyl)phenol (PubChem CID 100914371) has the molecular formula C22H30O
and a molecular weight of 310.48 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-(2,6-dimethylphenyl)phenol.
Molecular Properties
| Compound Name | 2,6-ditert-butyl-4-(2,6-dimethylphenyl)phenol |
| PubChem CID | 100914371 |
| Molecular Formula | C22H30O |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | 2,6-ditert-butyl-4-(2,6-dimethylphenyl)phenol |
| SMILES | Cc1cccc(C)c1-c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C22H30O/c1-14-10-9-11-15(2)19(14)16-12-17(21(3,4)5)20(23)18(13-16)22(6,7)8/h9-13,23H,1-8H3 |
| InChIKey | LPXNILSIDAQONC-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,6-ditert-butyl-4-(2,6-dimethylphenyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-ditert-butyl-4-(2,6-dimethylphenyl)phenol?
The IUPAC name of 2,6-ditert-butyl-4-(2,6-dimethylphenyl)phenol (CID 100914371) is 2,6-ditert-butyl-4-(2,6-dimethylphenyl)phenol.
What is the SMILES notation for 2,6-ditert-butyl-4-(2,6-dimethylphenyl)phenol?
The canonical SMILES for 2,6-ditert-butyl-4-(2,6-dimethylphenyl)phenol is Cc1cccc(C)c1-c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1.
What is the InChIKey of 2,6-ditert-butyl-4-(2,6-dimethylphenyl)phenol?
The InChIKey is LPXNILSIDAQONC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30O/c1-14-10-9-11-15(2)19(14)16-12-17(21(3,4)5)20(23)18(13-16)22(6,7)8/h9-13,23H,1-8H3.
What are the key properties of 2,6-ditert-butyl-4-(2,6-dimethylphenyl)phenol?
2,6-ditert-butyl-4-(2,6-dimethylphenyl)phenol has a molecular weight of 310.48 g/mol, XLogP of 6.27, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-ditert-butyl-4-(2,6-dimethylphenyl)phenol is sourced from PubChem (CID 100914371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).