C22H30O — CID 100914371
2,6-ditert-butyl-4-(2,6-dimethylphenyl)phenol (PubChem CID 100914371) has the molecular formula C22H30O and a molecular weight of 310.48 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-(2,6-dimethylphenyl)phenol.
| Compound Name | 2,6-ditert-butyl-4-(2,6-dimethylphenyl)phenol |
|---|---|
| PubChem CID | 100914371 |
| Molecular Formula | C22H30O |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | 2,6-ditert-butyl-4-(2,6-dimethylphenyl)phenol |
| SMILES | Cc1cccc(C)c1-c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C22H30O/c1-14-10-9-11-15(2)19(14)16-12-17(21(3,4)5)20(23)18(13-16)22(6,7)8/h9-13,23H,1-8H3 |
| InChIKey | LPXNILSIDAQONC-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |