C14H28N2O2 — CID 174824895
2,6-ditert-butylphenol;hydrazine;hydrate (PubChem CID 174824895) has the molecular formula C14H28N2O2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 2,6-ditert-butylphenol;hydrazine;hydrate.
| Compound Name | 2,6-ditert-butylphenol;hydrazine;hydrate |
|---|---|
| PubChem CID | 174824895 |
| Molecular Formula | C14H28N2O2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | 2,6-ditert-butylphenol;hydrazine;hydrate |
| SMILES | CC(C)(C)c1cccc(C(C)(C)C)c1O.NN.O |
| InChI | InChI=1S/C14H22O.H4N2.H2O/c1-13(2,3)10-8-7-9-11(12(10)15)14(4,5)6;1-2;/h7-9,15H,1-6H3;1-2H2;1H2 |
| InChIKey | MSHLLMVNPSNQNM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|