C15H28Al2O2 — CID 173269586
alumanyloxy(methyl)alumane;2,6-ditert-butylphenol (PubChem CID 173269586) has the molecular formula C15H28Al2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is alumanyloxy(methyl)alumane;2,6-ditert-butylphenol.
| Compound Name | alumanyloxy(methyl)alumane;2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 173269586 |
| Molecular Formula | C15H28Al2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | alumanyloxy(methyl)alumane;2,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cccc(C(C)(C)C)c1O.C[AlH]O[AlH2] |
| InChI | InChI=1S/C14H22O.CH3.2Al.O.3H/c1-13(2,3)10-8-7-9-11(12(10)15)14(4,5)6;;;;;;;/h7-9,15H,1-6H3;1H3;;;;;; |
| InChIKey | DFTKFWAMHGLSFN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |