C28H42O2 — CID 22163155
2,6-ditert-butyl-4-(2,6-ditert-butylphenoxy)phenol (PubChem CID 22163155) has the molecular formula C28H42O2 and a molecular weight of 410.64 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-(2,6-ditert-butylphenoxy)phenol.
| Compound Name | 2,6-ditert-butyl-4-(2,6-ditert-butylphenoxy)phenol |
|---|---|
| PubChem CID | 22163155 |
| Molecular Formula | C28H42O2 |
| Molecular Weight | 410.64 g/mol |
| Exact Mass | 410.32 |
| IUPAC Name | 2,6-ditert-butyl-4-(2,6-ditert-butylphenoxy)phenol |
| SMILES | CC(C)(C)c1cc(Oc2c(C(C)(C)C)cccc2C(C)(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C28H42O2/c1-25(2,3)19-14-13-15-20(26(4,5)6)24(19)30-18-16-21(27(7,8)9)23(29)22(17-18)28(10,11)12/h13-17,29H,1-12H3 |
| InChIKey | ZZYGWJMKAOCRKE-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.64 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |