C18H33NO — CID 71675640
2,6-ditert-butylphenol;N-ethylethanamine (PubChem CID 71675640) has the molecular formula C18H33NO and a molecular weight of 279.47 g/mol. Its IUPAC name is 2,6-ditert-butylphenol;N-ethylethanamine.
| Compound Name | 2,6-ditert-butylphenol;N-ethylethanamine |
|---|---|
| PubChem CID | 71675640 |
| Molecular Formula | C18H33NO |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.26 |
| IUPAC Name | 2,6-ditert-butylphenol;N-ethylethanamine |
| SMILES | CC(C)(C)c1cccc(C(C)(C)C)c1O.CCNCC |
| InChI | InChI=1S/C14H22O.C4H11N/c1-13(2,3)10-8-7-9-11(12(10)15)14(4,5)6;1-3-5-4-2/h7-9,15H,1-6H3;5H,3-4H2,1-2H3 |
| InChIKey | OLRFOFUSKNWXIX-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |