C49H68O3 — CID 141055802
4-[3,5-bis(3,5-ditert-butyl-4-hydroxyphenyl)-4-methylphenyl]-2,6-ditert-butylphenol (PubChem CID 141055802) has the molecular formula C49H68O3 and a molecular weight of 705.08 g/mol. Its IUPAC name is 4-[3,5-bis(3,5-ditert-butyl-4-hydroxyphenyl)-4-methylphenyl]-2,6-ditert-butylphenol.
| Compound Name | 4-[3,5-bis(3,5-ditert-butyl-4-hydroxyphenyl)-4-methylphenyl]-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 141055802 |
| Molecular Formula | C49H68O3 |
| Molecular Weight | 705.08 g/mol |
| Exact Mass | 704.52 |
| IUPAC Name | 4-[3,5-bis(3,5-ditert-butyl-4-hydroxyphenyl)-4-methylphenyl]-2,6-ditert-butylphenol |
| SMILES | Cc1c(-c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(-c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc1-c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C49H68O3/c1-28-33(31-24-37(46(8,9)10)42(51)38(25-31)47(11,12)13)20-29(30-22-35(44(2,3)4)41(50)36(23-30)45(5,6)7)21-34(28)32-26-39(48(14,15)16)43(52)40(27-32)49(17,18)19/h20-27,50-52H,1-19H3 |
| InChIKey | YBAYKIZUWWDYBJ-UHFFFAOYSA-N |
| XLogP | 13.90 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.08 |
| LogP ≤ 5 | 13.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |