C24H26O4 — CID 91563497
3-(3,5-ditert-butyl-4-hydroxyphenyl)naphthalene-1,2,4-trione (PubChem CID 91563497) has the molecular formula C24H26O4 and a molecular weight of 378.47 g/mol. Its IUPAC name is 3-(3,5-ditert-butyl-4-hydroxyphenyl)naphthalene-1,2,4-trione.
| Compound Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)naphthalene-1,2,4-trione |
|---|---|
| PubChem CID | 91563497 |
| Molecular Formula | C24H26O4 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)naphthalene-1,2,4-trione |
| SMILES | CC(C)(C)c1cc(C2C(=O)C(=O)c3ccccc3C2=O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C24H26O4/c1-23(2,3)16-11-13(12-17(21(16)27)24(4,5)6)18-19(25)14-9-7-8-10-15(14)20(26)22(18)28/h7-12,18,27H,1-6H3 |
| InChIKey | POBYYFLHFGSCNB-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|