C34H34NO5+ — CID 142527530
[2-(1,3-dioxoinden-2-yl)quinolin-1-ium-8-yl] 2-(3,5-ditert-butyl-4-hydroxyphenyl)acetate (PubChem CID 142527530) has the molecular formula C34H34NO5+ and a molecular weight of 536.65 g/mol. Its IUPAC name is [2-(1,3-dioxoinden-2-yl)quinolin-1-ium-8-yl] 2-(3,5-ditert-butyl-4-hydroxyphenyl)acetate.
| Compound Name | [2-(1,3-dioxoinden-2-yl)quinolin-1-ium-8-yl] 2-(3,5-ditert-butyl-4-hydroxyphenyl)acetate |
|---|---|
| PubChem CID | 142527530 |
| Molecular Formula | C34H34NO5+ |
| Molecular Weight | 536.65 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | [2-(1,3-dioxoinden-2-yl)quinolin-1-ium-8-yl] 2-(3,5-ditert-butyl-4-hydroxyphenyl)acetate |
| SMILES | CC(C)(C)c1cc(CC(=O)Oc2cccc3ccc(C4C(=O)c5ccccc5C4=O)[nH+]c23)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C34H33NO5/c1-33(2,3)23-16-19(17-24(32(23)39)34(4,5)6)18-27(36)40-26-13-9-10-20-14-15-25(35-29(20)26)28-30(37)21-11-7-8-12-22(21)31(28)38/h7-17,28,39H,18H2,1-6H3/p+1 |
| InChIKey | OCVRBNGQULCKCG-UHFFFAOYSA-O |
| XLogP | 6.27 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.65 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|