C25H30OS — CID 19776189
2,6-ditert-butyl-4-[(2-sulfanylnaphthalen-1-yl)methyl]phenol (PubChem CID 19776189) has the molecular formula C25H30OS and a molecular weight of 378.58 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(2-sulfanylnaphthalen-1-yl)methyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[(2-sulfanylnaphthalen-1-yl)methyl]phenol |
|---|---|
| PubChem CID | 19776189 |
| Molecular Formula | C25H30OS |
| Molecular Weight | 378.58 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 2,6-ditert-butyl-4-[(2-sulfanylnaphthalen-1-yl)methyl]phenol |
| SMILES | CC(C)(C)c1cc(Cc2c(S)ccc3ccccc23)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C25H30OS/c1-24(2,3)20-14-16(15-21(23(20)26)25(4,5)6)13-19-18-10-8-7-9-17(18)11-12-22(19)27/h7-12,14-15,26-27H,13H2,1-6H3 |
| InChIKey | WFKIJNCDTMQNCU-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.58 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|