C23H33NO — CID 10640840
2,6-ditert-butyl-4-[[2-(dimethylamino)phenyl]methyl]phenol (PubChem CID 10640840) has the molecular formula C23H33NO and a molecular weight of 339.52 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[[2-(dimethylamino)phenyl]methyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[[2-(dimethylamino)phenyl]methyl]phenol |
|---|---|
| PubChem CID | 10640840 |
| Molecular Formula | C23H33NO |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.26 |
| IUPAC Name | 2,6-ditert-butyl-4-[[2-(dimethylamino)phenyl]methyl]phenol |
| SMILES | CN(C)c1ccccc1Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C23H33NO/c1-22(2,3)18-14-16(15-19(21(18)25)23(4,5)6)13-17-11-9-10-12-20(17)24(7)8/h9-12,14-15,25H,13H2,1-8H3 |
| InChIKey | OSFPVXQZNNFOOB-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |