C80H116O4 — CID 159788549
2,6-ditert-butyl-4-[[4-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2,3,5,6-tetramethylphenyl]methyl]phenol (PubChem CID 159788549) has the molecular formula C80H116O4 and a molecular weight of 1141.80 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[[4-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2,3,5,6-tetramethylphenyl]methyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[[4-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2,3,5,6-tetramethylphenyl]methyl]phenol |
|---|---|
| PubChem CID | 159788549 |
| Molecular Formula | C80H116O4 |
| Molecular Weight | 1141.80 g/mol |
| Exact Mass | 1140.89 |
| IUPAC Name | 2,6-ditert-butyl-4-[[4-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2,3,5,6-tetramethylphenyl]methyl]phenol |
| SMILES | Cc1c(C)c(Cc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)c(C)c(C)c1Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1.Cc1c(C)c(Cc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)c(C)c(C)c1Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/2C40H58O2/c2*1-23-24(2)30(18-28-21-33(39(11,12)13)36(42)34(22-28)40(14,15)16)26(4)25(3)29(23)17-27-19-31(37(5,6)7)35(41)32(20-27)38(8,9)10/h2*19-22,41-42H,17-18H2,1-16H3 |
| InChIKey | NIGNUIPZCBJTJO-UHFFFAOYSA-N |
| XLogP | 21.41 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1141.80 |
| LogP ≤ 5 | 21.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |