C63H96O3 — CID 137459723
2,6-ditert-butyl-4-[[2,4,6-tributyl-3,5-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]phenyl]methyl]phenol (PubChem CID 137459723) has the molecular formula C63H96O3 and a molecular weight of 901.46 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[[2,4,6-tributyl-3,5-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]phenyl]methyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[[2,4,6-tributyl-3,5-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]phenyl]methyl]phenol |
|---|---|
| PubChem CID | 137459723 |
| Molecular Formula | C63H96O3 |
| Molecular Weight | 901.46 g/mol |
| Exact Mass | 900.74 |
| IUPAC Name | 2,6-ditert-butyl-4-[[2,4,6-tributyl-3,5-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]phenyl]methyl]phenol |
| SMILES | CCCCc1c(Cc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)c(CCCC)c(Cc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)c(CCCC)c1Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C63H96O3/c1-22-25-28-43-46(31-40-34-49(58(4,5)6)55(64)50(35-40)59(7,8)9)44(29-26-23-2)48(33-42-38-53(62(16,17)18)57(66)54(39-42)63(19,20)21)45(30-27-24-3)47(43)32-41-36-51(60(10,11)12)56(65)52(37-41)61(13,14)15/h34-39,64-66H,22-33H2,1-21H3 |
| InChIKey | YFQRYKWVFDOAAF-UHFFFAOYSA-N |
| XLogP | 17.39 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 901.46 |
| LogP ≤ 5 | 17.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |