C24H34O2S — CID 87160979
2-butyl-4-[(3-tert-butyl-4-hydroxy-5-methylphenyl)methylsulfanylmethyl]-6-methylphenol (PubChem CID 87160979) has the molecular formula C24H34O2S and a molecular weight of 386.60 g/mol. Its IUPAC name is 2-butyl-4-[(3-tert-butyl-4-hydroxy-5-methylphenyl)methylsulfanylmethyl]-6-methylphenol.
| Compound Name | 2-butyl-4-[(3-tert-butyl-4-hydroxy-5-methylphenyl)methylsulfanylmethyl]-6-methylphenol |
|---|---|
| PubChem CID | 87160979 |
| Molecular Formula | C24H34O2S |
| Molecular Weight | 386.60 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | 2-butyl-4-[(3-tert-butyl-4-hydroxy-5-methylphenyl)methylsulfanylmethyl]-6-methylphenol |
| SMILES | CCCCc1cc(CSCc2cc(C)c(O)c(C(C)(C)C)c2)cc(C)c1O |
| InChI | InChI=1S/C24H34O2S/c1-7-8-9-20-12-18(10-16(2)22(20)25)14-27-15-19-11-17(3)23(26)21(13-19)24(4,5)6/h10-13,25-26H,7-9,14-15H2,1-6H3 |
| InChIKey | VEARDZKPOSGVJV-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.60 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |