C30H54OS2 — CID 155191739
2-tert-butyl-4,6-bis(2-octylsulfanylethyl)phenol (PubChem CID 155191739) has the molecular formula C30H54OS2 and a molecular weight of 494.90 g/mol. Its IUPAC name is 2-tert-butyl-4,6-bis(2-octylsulfanylethyl)phenol.
| Compound Name | 2-tert-butyl-4,6-bis(2-octylsulfanylethyl)phenol |
|---|---|
| PubChem CID | 155191739 |
| Molecular Formula | C30H54OS2 |
| Molecular Weight | 494.90 g/mol |
| Exact Mass | 494.36 |
| IUPAC Name | 2-tert-butyl-4,6-bis(2-octylsulfanylethyl)phenol |
| SMILES | CCCCCCCCSCCc1cc(CCSCCCCCCCC)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C30H54OS2/c1-6-8-10-12-14-16-20-32-22-18-26-24-27(29(31)28(25-26)30(3,4)5)19-23-33-21-17-15-13-11-9-7-2/h24-25,31H,6-23H2,1-5H3 |
| InChIKey | QMUIPUFSYXMRTK-UHFFFAOYSA-N |
| XLogP | 9.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.90 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|