C54H81N3O3 — CID 174668759
4-[[3,5-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2,4,6-tris(methylamino)phenyl]methyl]-2,6-ditert-butylphenol (PubChem CID 174668759) has the molecular formula C54H81N3O3 and a molecular weight of 820.26 g/mol. Its IUPAC name is 4-[[3,5-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2,4,6-tris(methylamino)phenyl]methyl]-2,6-ditert-butylphenol.
| Compound Name | 4-[[3,5-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2,4,6-tris(methylamino)phenyl]methyl]-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 174668759 |
| Molecular Formula | C54H81N3O3 |
| Molecular Weight | 820.26 g/mol |
| Exact Mass | 819.63 |
| IUPAC Name | 4-[[3,5-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2,4,6-tris(methylamino)phenyl]methyl]-2,6-ditert-butylphenol |
| SMILES | CNc1c(Cc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)c(NC)c(Cc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)c(NC)c1Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C54H81N3O3/c1-49(2,3)37-25-31(26-38(46(37)58)50(4,5)6)22-34-43(55-19)35(23-32-27-39(51(7,8)9)47(59)40(28-32)52(10,11)12)45(57-21)36(44(34)56-20)24-33-29-41(53(13,14)15)48(60)42(30-33)54(16,17)18/h25-30,55-60H,22-24H2,1-21H3 |
| InChIKey | GZXZAANWUYGPNW-UHFFFAOYSA-N |
| XLogP | 13.49 |
| TPSA | 96.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.26 |
| LogP ≤ 5 | 13.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |