C54H78O9S3 — CID 87994100
4-[[3,5-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2,4,6-tris(methylsulfonyl)phenyl]methyl]-2,6-ditert-butylphenol (PubChem CID 87994100) has the molecular formula C54H78O9S3 and a molecular weight of 967.41 g/mol. Its IUPAC name is 4-[[3,5-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2,4,6-tris(methylsulfonyl)phenyl]methyl]-2,6-ditert-butylphenol.
| Compound Name | 4-[[3,5-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2,4,6-tris(methylsulfonyl)phenyl]methyl]-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 87994100 |
| Molecular Formula | C54H78O9S3 |
| Molecular Weight | 967.41 g/mol |
| Exact Mass | 966.48 |
| IUPAC Name | 4-[[3,5-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2,4,6-tris(methylsulfonyl)phenyl]methyl]-2,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(Cc2c(S(C)(=O)=O)c(Cc3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)c(S(C)(=O)=O)c(Cc3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)c2S(C)(=O)=O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C54H78O9S3/c1-49(2,3)37-25-31(26-38(43(37)55)50(4,5)6)22-34-46(64(19,58)59)35(23-32-27-39(51(7,8)9)44(56)40(28-32)52(10,11)12)48(66(21,62)63)36(47(34)65(20,60)61)24-33-29-41(53(13,14)15)45(57)42(30-33)54(16,17)18/h25-30,55-57H,22-24H2,1-21H3 |
| InChIKey | QKQVDSWRRPTENH-UHFFFAOYSA-N |
| XLogP | 11.57 |
| TPSA | 163.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 967.41 |
| LogP ≤ 5 | 11.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |