C33H40O3 — CID 175357707
1-[4-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2,3,5,6-tetramethylphenyl]-2-phenylethane-1,2-dione (PubChem CID 175357707) has the molecular formula C33H40O3 and a molecular weight of 484.68 g/mol. Its IUPAC name is 1-[4-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2,3,5,6-tetramethylphenyl]-2-phenylethane-1,2-dione.
| Compound Name | 1-[4-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2,3,5,6-tetramethylphenyl]-2-phenylethane-1,2-dione |
|---|---|
| PubChem CID | 175357707 |
| Molecular Formula | C33H40O3 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.30 |
| IUPAC Name | 1-[4-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2,3,5,6-tetramethylphenyl]-2-phenylethane-1,2-dione |
| SMILES | Cc1c(C)c(C(=O)C(=O)c2ccccc2)c(C)c(C)c1Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C33H40O3/c1-19-21(3)28(31(36)29(34)24-14-12-11-13-15-24)22(4)20(2)25(19)16-23-17-26(32(5,6)7)30(35)27(18-23)33(8,9)10/h11-15,17-18,35H,16H2,1-10H3 |
| InChIKey | ZKFZPYDWWVBVRA-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|