C26H34O3 — CID 57052682
3-[2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-4-methylphenyl]-2-methylprop-2-enoic acid (PubChem CID 57052682) has the molecular formula C26H34O3 and a molecular weight of 394.56 g/mol. Its IUPAC name is 3-[2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-4-methylphenyl]-2-methylprop-2-enoic acid.
| Compound Name | 3-[2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-4-methylphenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 57052682 |
| Molecular Formula | C26H34O3 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | 3-[2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-4-methylphenyl]-2-methylprop-2-enoic acid |
| SMILES | CC(=Cc1ccc(C)cc1Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)C(=O)O |
| InChI | InChI=1S/C26H34O3/c1-16-9-10-19(12-17(2)24(28)29)20(11-16)13-18-14-21(25(3,4)5)23(27)22(15-18)26(6,7)8/h9-12,14-15,27H,13H2,1-8H3,(H,28,29) |
| InChIKey | PCBGZAQUSXTEKC-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|