C26H36O4 — CID 175171517
2-tert-butyl-6-[(3-tert-butyl-4-hydroxy-5-methylphenyl)methyl]-4-methylphenol;prop-2-enoic acid (PubChem CID 175171517) has the molecular formula C26H36O4 and a molecular weight of 412.57 g/mol. Its IUPAC name is 2-tert-butyl-6-[(3-tert-butyl-4-hydroxy-5-methylphenyl)methyl]-4-methylphenol;prop-2-enoic acid.
| Compound Name | 2-tert-butyl-6-[(3-tert-butyl-4-hydroxy-5-methylphenyl)methyl]-4-methylphenol;prop-2-enoic acid |
|---|---|
| PubChem CID | 175171517 |
| Molecular Formula | C26H36O4 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | 2-tert-butyl-6-[(3-tert-butyl-4-hydroxy-5-methylphenyl)methyl]-4-methylphenol;prop-2-enoic acid |
| SMILES | C=CC(=O)O.Cc1cc(Cc2cc(C)c(O)c(C(C)(C)C)c2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C23H32O2.C3H4O2/c1-14-9-17(21(25)18(10-14)22(3,4)5)12-16-11-15(2)20(24)19(13-16)23(6,7)8;1-2-3(4)5/h9-11,13,24-25H,12H2,1-8H3;2H,1H2,(H,4,5) |
| InChIKey | QPBYNUWRHRPTEL-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|