C26H34O3 — CID 87424514
3-[2-tert-butyl-5-[(3-tert-butyl-2-hydroxy-5-methylphenyl)methyl]-4-methylphenyl]prop-2-enoic acid (PubChem CID 87424514) has the molecular formula C26H34O3 and a molecular weight of 394.56 g/mol. Its IUPAC name is 3-[2-tert-butyl-5-[(3-tert-butyl-2-hydroxy-5-methylphenyl)methyl]-4-methylphenyl]prop-2-enoic acid.
| Compound Name | 3-[2-tert-butyl-5-[(3-tert-butyl-2-hydroxy-5-methylphenyl)methyl]-4-methylphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 87424514 |
| Molecular Formula | C26H34O3 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | 3-[2-tert-butyl-5-[(3-tert-butyl-2-hydroxy-5-methylphenyl)methyl]-4-methylphenyl]prop-2-enoic acid |
| SMILES | Cc1cc(Cc2cc(C=CC(=O)O)c(C(C)(C)C)cc2C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C26H34O3/c1-16-11-20(24(29)22(12-16)26(6,7)8)15-19-14-18(9-10-23(27)28)21(13-17(19)2)25(3,4)5/h9-14,29H,15H2,1-8H3,(H,27,28) |
| InChIKey | DFDQCVUAXQPMIB-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|