3-(2,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoic acid

C17H24O3 — CID 74015197

IUPAC3-(2,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoic acid
SMILESCC(C)(C)c1cc(C=CC(=O)O)c(C(C)(C)C)cc1O
InChIInChI=1S/C17H24O3/c1-16(2,3)12-10-14(18)13(17(4,5)6)9-11(12)7-8-15(19)20/h7-10,18H,1-6H3,(H,19,20)
InChIKeyDTJCETVXRRPAKA-UHFFFAOYSA-N
MW276.38 g/mol
LogP4.09
Rot. Bonds2

About 3-(2,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoic acid

3-(2,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoic acid (PubChem CID 74015197) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is 3-(2,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoic acid.

Molecular Properties

Compound Name3-(2,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoic acid
PubChem CID74015197
Molecular FormulaC17H24O3
Molecular Weight276.38 g/mol
Exact Mass276.17
IUPAC Name3-(2,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoic acid
SMILESCC(C)(C)c1cc(C=CC(=O)O)c(C(C)(C)C)cc1O
InChIInChI=1S/C17H24O3/c1-16(2,3)12-10-14(18)13(17(4,5)6)9-11(12)7-8-15(19)20/h7-10,18H,1-6H3,(H,19,20)
InChIKeyDTJCETVXRRPAKA-UHFFFAOYSA-N
XLogP4.09
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.38
LogP ≤ 54.09
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 3-(2,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoic acid?
The IUPAC name of 3-(2,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoic acid (CID 74015197) is 3-(2,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoic acid.
What is the SMILES notation for 3-(2,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoic acid?
The canonical SMILES for 3-(2,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoic acid is CC(C)(C)c1cc(C=CC(=O)O)c(C(C)(C)C)cc1O.
What is the InChIKey of 3-(2,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoic acid?
The InChIKey is DTJCETVXRRPAKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24O3/c1-16(2,3)12-10-14(18)13(17(4,5)6)9-11(12)7-8-15(19)20/h7-10,18H,1-6H3,(H,19,20).
What are the key properties of 3-(2,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoic acid?
3-(2,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoic acid has a molecular weight of 276.38 g/mol, XLogP of 4.09, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoic acid is sourced from PubChem (CID 74015197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).