C17H24O3 — CID 74015197
3-(2,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoic acid (PubChem CID 74015197) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is 3-(2,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoic acid.
| Compound Name | 3-(2,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 74015197 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 3-(2,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoic acid |
| SMILES | CC(C)(C)c1cc(C=CC(=O)O)c(C(C)(C)C)cc1O |
| InChI | InChI=1S/C17H24O3/c1-16(2,3)12-10-14(18)13(17(4,5)6)9-11(12)7-8-15(19)20/h7-10,18H,1-6H3,(H,19,20) |
| InChIKey | DTJCETVXRRPAKA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|