C11H14O3 — CID 121218668
5-tert-butyl-2,4-dihydroxybenzaldehyde (PubChem CID 121218668) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is 5-tert-butyl-2,4-dihydroxybenzaldehyde.
| Compound Name | 5-tert-butyl-2,4-dihydroxybenzaldehyde |
|---|---|
| PubChem CID | 121218668 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 5-tert-butyl-2,4-dihydroxybenzaldehyde |
| SMILES | CC(C)(C)c1cc(C=O)c(O)cc1O |
| InChI | InChI=1S/C11H14O3/c1-11(2,3)8-4-7(6-12)9(13)5-10(8)14/h4-6,13-14H,1-3H3 |
| InChIKey | SWFJVKQMGQNEGQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|