C38H52O6S-2 — CID 54720210
2,6-ditert-butyl-4-[(E)-2-carboxyethenyl]-3-[2-[2-[2,4-ditert-butyl-6-[(E)-2-carboxyethenyl]-3-oxidophenyl]ethylsulfanyl]ethyl]phenolate (PubChem CID 54720210) has the molecular formula C38H52O6S-2 and a molecular weight of 636.90 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(E)-2-carboxyethenyl]-3-[2-[2-[2,4-ditert-butyl-6-[(E)-2-carboxyethenyl]-3-oxidophenyl]ethylsulfanyl]ethyl]phenolate.
| Compound Name | 2,6-ditert-butyl-4-[(E)-2-carboxyethenyl]-3-[2-[2-[2,4-ditert-butyl-6-[(E)-2-carboxyethenyl]-3-oxidophenyl]ethylsulfanyl]ethyl]phenolate |
|---|---|
| PubChem CID | 54720210 |
| Molecular Formula | C38H52O6S-2 |
| Molecular Weight | 636.90 g/mol |
| Exact Mass | 636.35 |
| IUPAC Name | 2,6-ditert-butyl-4-[(E)-2-carboxyethenyl]-3-[2-[2-[2,4-ditert-butyl-6-[(E)-2-carboxyethenyl]-3-oxidophenyl]ethylsulfanyl]ethyl]phenolate |
| SMILES | CC(C)(C)c1cc(/C=C/C(=O)O)c(CCSCCc2c(/C=C/C(=O)O)cc(C(C)(C)C)c([O-])c2C(C)(C)C)c(C(C)(C)C)c1[O-] |
| InChI | InChI=1S/C38H54O6S/c1-35(2,3)27-21-23(13-15-29(39)40)25(31(33(27)43)37(7,8)9)17-19-45-20-18-26-24(14-16-30(41)42)22-28(36(4,5)6)34(44)32(26)38(10,11)12/h13-16,21-22,43-44H,17-20H2,1-12H3,(H,39,40)(H,41,42)/p-2/b15-13+,16-14+ |
| InChIKey | RVFCHWFXDQKDKJ-WXUKJITCSA-L |
| XLogP | 7.74 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.90 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|