C35H44O4 — CID 19759955
(E)-3-[2,6-bis[(3-tert-butyl-2-hydroxy-5-methylphenyl)methyl]-4-methylphenyl]-2-methylprop-2-enoic acid (PubChem CID 19759955) has the molecular formula C35H44O4 and a molecular weight of 528.73 g/mol. Its IUPAC name is (E)-3-[2,6-bis[(3-tert-butyl-2-hydroxy-5-methylphenyl)methyl]-4-methylphenyl]-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-[2,6-bis[(3-tert-butyl-2-hydroxy-5-methylphenyl)methyl]-4-methylphenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 19759955 |
| Molecular Formula | C35H44O4 |
| Molecular Weight | 528.73 g/mol |
| Exact Mass | 528.32 |
| IUPAC Name | (E)-3-[2,6-bis[(3-tert-butyl-2-hydroxy-5-methylphenyl)methyl]-4-methylphenyl]-2-methylprop-2-enoic acid |
| SMILES | C/C(=C\c1c(Cc2cc(C)cc(C(C)(C)C)c2O)cc(C)cc1Cc1cc(C)cc(C(C)(C)C)c1O)C(=O)O |
| InChI | InChI=1S/C35H44O4/c1-20-11-24(18-26-13-21(2)15-29(31(26)36)34(5,6)7)28(17-23(4)33(38)39)25(12-20)19-27-14-22(3)16-30(32(27)37)35(8,9)10/h11-17,36-37H,18-19H2,1-10H3,(H,38,39)/b23-17+ |
| InChIKey | MOHBGYDMGRRSAW-HAVVHWLPSA-N |
| XLogP | 8.29 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.73 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|