C22H31NO3S — CID 175985841
2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-4-methylbenzenesulfonamide (PubChem CID 175985841) has the molecular formula C22H31NO3S and a molecular weight of 389.56 g/mol. Its IUPAC name is 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-4-methylbenzenesulfonamide.
| Compound Name | 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 175985841 |
| Molecular Formula | C22H31NO3S |
| Molecular Weight | 389.56 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(N)(=O)=O)c(Cc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C22H31NO3S/c1-14-8-9-19(27(23,25)26)16(10-14)11-15-12-17(21(2,3)4)20(24)18(13-15)22(5,6)7/h8-10,12-13,24H,11H2,1-7H3,(H2,23,25,26) |
| InChIKey | JWIRJBICEUFGCI-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.56 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |