C9H13NO3S — CID 67168218
2-(2-hydroxyethyl)-4-methylbenzenesulfonamide (PubChem CID 67168218) has the molecular formula C9H13NO3S and a molecular weight of 215.27 g/mol. Its IUPAC name is 2-(2-hydroxyethyl)-4-methylbenzenesulfonamide.
| Compound Name | 2-(2-hydroxyethyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 67168218 |
| Molecular Formula | C9H13NO3S |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 2-(2-hydroxyethyl)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(N)(=O)=O)c(CCO)c1 |
| InChI | InChI=1S/C9H13NO3S/c1-7-2-3-9(14(10,12)13)8(6-7)4-5-11/h2-3,6,11H,4-5H2,1H3,(H2,10,12,13) |
| InChIKey | LTDCHKFYPYBESP-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |