C9H10F3NO3S — CID 140565047
2-(2-hydroxyethyl)-5-(trifluoromethyl)benzenesulfonamide (PubChem CID 140565047) has the molecular formula C9H10F3NO3S and a molecular weight of 269.24 g/mol. Its IUPAC name is 2-(2-hydroxyethyl)-5-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 2-(2-hydroxyethyl)-5-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 140565047 |
| Molecular Formula | C9H10F3NO3S |
| Molecular Weight | 269.24 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | 2-(2-hydroxyethyl)-5-(trifluoromethyl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(C(F)(F)F)ccc1CCO |
| InChI | InChI=1S/C9H10F3NO3S/c10-9(11,12)7-2-1-6(3-4-14)8(5-7)17(13,15)16/h1-2,5,14H,3-4H2,(H2,13,15,16) |
| InChIKey | XNPXWQXGFIPZLF-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.24 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |