C25H32O3 — CID 56992584
3-[2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]phenyl]-2-methylprop-2-enoic acid (PubChem CID 56992584) has the molecular formula C25H32O3 and a molecular weight of 380.53 g/mol. Its IUPAC name is 3-[2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]phenyl]-2-methylprop-2-enoic acid.
| Compound Name | 3-[2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]phenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 56992584 |
| Molecular Formula | C25H32O3 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | 3-[2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]phenyl]-2-methylprop-2-enoic acid |
| SMILES | CC(=Cc1ccccc1Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)C(=O)O |
| InChI | InChI=1S/C25H32O3/c1-16(23(27)28)12-18-10-8-9-11-19(18)13-17-14-20(24(2,3)4)22(26)21(15-17)25(5,6)7/h8-12,14-15,26H,13H2,1-7H3,(H,27,28) |
| InChIKey | YXGPRAYPWKMOKT-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|