C19H24Cl3NO — CID 23046417
2,6-ditert-butyl-4-[(2,4,5-trichloro-1H-pyrrol-3-yl)methyl]phenol (PubChem CID 23046417) has the molecular formula C19H24Cl3NO and a molecular weight of 388.77 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(2,4,5-trichloro-1H-pyrrol-3-yl)methyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[(2,4,5-trichloro-1H-pyrrol-3-yl)methyl]phenol |
|---|---|
| PubChem CID | 23046417 |
| Molecular Formula | C19H24Cl3NO |
| Molecular Weight | 388.77 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 2,6-ditert-butyl-4-[(2,4,5-trichloro-1H-pyrrol-3-yl)methyl]phenol |
| SMILES | CC(C)(C)c1cc(Cc2c(Cl)[nH]c(Cl)c2Cl)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C19H24Cl3NO/c1-18(2,3)12-8-10(9-13(15(12)24)19(4,5)6)7-11-14(20)17(22)23-16(11)21/h8-9,23-24H,7H2,1-6H3 |
| InChIKey | JEHIVTRGANMSCV-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.77 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |