C61H102O3 — CID 160518697
2,6-ditert-butyl-4-(3-butylheptyl)phenol;2,6-ditert-butyl-4-[8-(3,5-ditert-butyl-4-hydroxyphenyl)octyl]phenol (PubChem CID 160518697) has the molecular formula C61H102O3 and a molecular weight of 883.48 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-(3-butylheptyl)phenol;2,6-ditert-butyl-4-[8-(3,5-ditert-butyl-4-hydroxyphenyl)octyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-(3-butylheptyl)phenol;2,6-ditert-butyl-4-[8-(3,5-ditert-butyl-4-hydroxyphenyl)octyl]phenol |
|---|---|
| PubChem CID | 160518697 |
| Molecular Formula | C61H102O3 |
| Molecular Weight | 883.48 g/mol |
| Exact Mass | 882.78 |
| IUPAC Name | 2,6-ditert-butyl-4-(3-butylheptyl)phenol;2,6-ditert-butyl-4-[8-(3,5-ditert-butyl-4-hydroxyphenyl)octyl]phenol |
| SMILES | CC(C)(C)c1cc(CCCCCCCCc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O.CCCCC(CCCC)CCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C36H58O2.C25H44O/c1-33(2,3)27-21-25(22-28(31(27)37)34(4,5)6)19-17-15-13-14-16-18-20-26-23-29(35(7,8)9)32(38)30(24-26)36(10,11)12;1-9-11-13-19(14-12-10-2)15-16-20-17-21(24(3,4)5)23(26)22(18-20)25(6,7)8/h21-24,37-38H,13-20H2,1-12H3;17-19,26H,9-16H2,1-8H3 |
| InChIKey | QTZIHNNSTPKNAE-UHFFFAOYSA-N |
| XLogP | 18.33 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.48 |
| LogP ≤ 5 | 18.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|