C23H40Cl2OP+ — CID 88697912
dichloro-(2,6-ditert-butyl-4-nonylphenyl)-hydroxyphosphanium (PubChem CID 88697912) has the molecular formula C23H40Cl2OP+ and a molecular weight of 434.45 g/mol. Its IUPAC name is dichloro-(2,6-ditert-butyl-4-nonylphenyl)-hydroxyphosphanium.
| Compound Name | dichloro-(2,6-ditert-butyl-4-nonylphenyl)-hydroxyphosphanium |
|---|---|
| PubChem CID | 88697912 |
| Molecular Formula | C23H40Cl2OP+ |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | dichloro-(2,6-ditert-butyl-4-nonylphenyl)-hydroxyphosphanium |
| SMILES | CCCCCCCCCc1cc(C(C)(C)C)c([P+](O)(Cl)Cl)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C23H40Cl2OP/c1-8-9-10-11-12-13-14-15-18-16-19(22(2,3)4)21(27(24,25)26)20(17-18)23(5,6)7/h16-17,26H,8-15H2,1-7H3/q+1 |
| InChIKey | PQYZWCXAIYXAIQ-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|