C44H74Cl2N2O2Zr — CID 177212002
bis(2-tert-butyl-4-octyl-6-(propan-2-yliminomethyl)phenol);dichlorozirconium (PubChem CID 177212002) has the molecular formula C44H74Cl2N2O2Zr and a molecular weight of 825.22 g/mol. Its IUPAC name is bis(2-tert-butyl-4-octyl-6-(propan-2-yliminomethyl)phenol);dichlorozirconium.
| Compound Name | bis(2-tert-butyl-4-octyl-6-(propan-2-yliminomethyl)phenol);dichlorozirconium |
|---|---|
| PubChem CID | 177212002 |
| Molecular Formula | C44H74Cl2N2O2Zr |
| Molecular Weight | 825.22 g/mol |
| Exact Mass | 822.42 |
| IUPAC Name | bis(2-tert-butyl-4-octyl-6-(propan-2-yliminomethyl)phenol);dichlorozirconium |
| SMILES | CCCCCCCCc1cc(/C=N/C(C)C)c(O)c(C(C)(C)C)c1.CCCCCCCCc1cc(/C=N/C(C)C)c(O)c(C(C)(C)C)c1.Cl[Zr]Cl |
| InChI | InChI=1S/2C22H37NO.2ClH.Zr/c2*1-7-8-9-10-11-12-13-18-14-19(16-23-17(2)3)21(24)20(15-18)22(4,5)6;;;/h2*14-17,24H,7-13H2,1-6H3;2*1H;/q;;;;+2/p-2/b2*23-16+;;; |
| InChIKey | KGQTYTGYGSNCRR-OFKWATFSSA-L |
| XLogP | 14.22 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.22 |
| LogP ≤ 5 | 14.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|