C32H50O4 — CID 59837202
2-tert-butyl-6-[1-[3-tert-butyl-2-hydroxy-5-(3-hydroxypropyl)phenyl]butyl]-4-(5-hydroxypentyl)phenol (PubChem CID 59837202) has the molecular formula C32H50O4 and a molecular weight of 498.75 g/mol. Its IUPAC name is 2-tert-butyl-6-[1-[3-tert-butyl-2-hydroxy-5-(3-hydroxypropyl)phenyl]butyl]-4-(5-hydroxypentyl)phenol.
| Compound Name | 2-tert-butyl-6-[1-[3-tert-butyl-2-hydroxy-5-(3-hydroxypropyl)phenyl]butyl]-4-(5-hydroxypentyl)phenol |
|---|---|
| PubChem CID | 59837202 |
| Molecular Formula | C32H50O4 |
| Molecular Weight | 498.75 g/mol |
| Exact Mass | 498.37 |
| IUPAC Name | 2-tert-butyl-6-[1-[3-tert-butyl-2-hydroxy-5-(3-hydroxypropyl)phenyl]butyl]-4-(5-hydroxypentyl)phenol |
| SMILES | CCCC(c1cc(CCCO)cc(C(C)(C)C)c1O)c1cc(CCCCCO)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C32H50O4/c1-8-13-24(26-19-23(15-12-17-34)21-28(30(26)36)32(5,6)7)25-18-22(14-10-9-11-16-33)20-27(29(25)35)31(2,3)4/h18-21,24,33-36H,8-17H2,1-7H3 |
| InChIKey | KOHYAEIATHSNGB-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.75 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|