C25H34O2 — CID 89220492
2-[1-(3-tert-butyl-2-hydroxy-5-methylphenyl)butyl]-4-methyl-6-prop-1-en-2-ylphenol (PubChem CID 89220492) has the molecular formula C25H34O2 and a molecular weight of 366.55 g/mol. Its IUPAC name is 2-[1-(3-tert-butyl-2-hydroxy-5-methylphenyl)butyl]-4-methyl-6-prop-1-en-2-ylphenol.
| Compound Name | 2-[1-(3-tert-butyl-2-hydroxy-5-methylphenyl)butyl]-4-methyl-6-prop-1-en-2-ylphenol |
|---|---|
| PubChem CID | 89220492 |
| Molecular Formula | C25H34O2 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | 2-[1-(3-tert-butyl-2-hydroxy-5-methylphenyl)butyl]-4-methyl-6-prop-1-en-2-ylphenol |
| SMILES | C=C(C)c1cc(C)cc(C(CCC)c2cc(C)cc(C(C)(C)C)c2O)c1O |
| InChI | InChI=1S/C25H34O2/c1-9-10-18(20-12-16(4)11-19(15(2)3)23(20)26)21-13-17(5)14-22(24(21)27)25(6,7)8/h11-14,18,26-27H,2,9-10H2,1,3-8H3 |
| InChIKey | VFBRKWNRWGHUJM-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |