C26H40O2 — CID 142998907
2-[(3-tert-butyl-2-hydroxy-5-methylphenyl)methyl]-4-methyl-6-pentan-2-ylphenol;ethane (PubChem CID 142998907) has the molecular formula C26H40O2 and a molecular weight of 384.60 g/mol. Its IUPAC name is 2-[(3-tert-butyl-2-hydroxy-5-methylphenyl)methyl]-4-methyl-6-pentan-2-ylphenol;ethane.
| Compound Name | 2-[(3-tert-butyl-2-hydroxy-5-methylphenyl)methyl]-4-methyl-6-pentan-2-ylphenol;ethane |
|---|---|
| PubChem CID | 142998907 |
| Molecular Formula | C26H40O2 |
| Molecular Weight | 384.60 g/mol |
| Exact Mass | 384.30 |
| IUPAC Name | 2-[(3-tert-butyl-2-hydroxy-5-methylphenyl)methyl]-4-methyl-6-pentan-2-ylphenol;ethane |
| SMILES | CC.CCCC(C)c1cc(C)cc(Cc2cc(C)cc(C(C)(C)C)c2O)c1O |
| InChI | InChI=1S/C24H34O2.C2H6/c1-8-9-17(4)20-12-15(2)10-18(22(20)25)14-19-11-16(3)13-21(23(19)26)24(5,6)7;1-2/h10-13,17,25-26H,8-9,14H2,1-7H3;1-2H3 |
| InChIKey | ABBQWWWAQXXSGC-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.60 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |