C22H30O2 — CID 19706004
2-tert-butyl-6-[(4-tert-butyl-2-hydroxyphenyl)methyl]-4-methylphenol (PubChem CID 19706004) has the molecular formula C22H30O2 and a molecular weight of 326.48 g/mol. Its IUPAC name is 2-tert-butyl-6-[(4-tert-butyl-2-hydroxyphenyl)methyl]-4-methylphenol.
| Compound Name | 2-tert-butyl-6-[(4-tert-butyl-2-hydroxyphenyl)methyl]-4-methylphenol |
|---|---|
| PubChem CID | 19706004 |
| Molecular Formula | C22H30O2 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | 2-tert-butyl-6-[(4-tert-butyl-2-hydroxyphenyl)methyl]-4-methylphenol |
| SMILES | Cc1cc(Cc2ccc(C(C)(C)C)cc2O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C22H30O2/c1-14-10-16(20(24)18(11-14)22(5,6)7)12-15-8-9-17(13-19(15)23)21(2,3)4/h8-11,13,23-24H,12H2,1-7H3 |
| InChIKey | HNNRXMVMHVGKHY-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |