C16H26O — CID 90297655
2-tert-butyl-4-methyl-6-[(2R)-pentan-2-yl]phenol (PubChem CID 90297655) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is 2-tert-butyl-4-methyl-6-[(2R)-pentan-2-yl]phenol.
| Compound Name | 2-tert-butyl-4-methyl-6-[(2R)-pentan-2-yl]phenol |
|---|---|
| PubChem CID | 90297655 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | 2-tert-butyl-4-methyl-6-[(2R)-pentan-2-yl]phenol |
| SMILES | CCC[C@@H](C)c1cc(C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C16H26O/c1-7-8-12(3)13-9-11(2)10-14(15(13)17)16(4,5)6/h9-10,12,17H,7-8H2,1-6H3/t12-/m1/s1 |
| InChIKey | GNEILQJCVGDDDF-GFCCVEGCSA-N |
| XLogP | 4.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |