C17H28OS — CID 83943023
3-(3-tert-butyl-2-ethoxy-5-methylphenyl)butane-1-thiol (PubChem CID 83943023) has the molecular formula C17H28OS and a molecular weight of 280.48 g/mol. Its IUPAC name is 3-(3-tert-butyl-2-ethoxy-5-methylphenyl)butane-1-thiol.
| Compound Name | 3-(3-tert-butyl-2-ethoxy-5-methylphenyl)butane-1-thiol |
|---|---|
| PubChem CID | 83943023 |
| Molecular Formula | C17H28OS |
| Molecular Weight | 280.48 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 3-(3-tert-butyl-2-ethoxy-5-methylphenyl)butane-1-thiol |
| SMILES | CCOc1c(C(C)CCS)cc(C)cc1C(C)(C)C |
| InChI | InChI=1S/C17H28OS/c1-7-18-16-14(13(3)8-9-19)10-12(2)11-15(16)17(4,5)6/h10-11,13,19H,7-9H2,1-6H3 |
| InChIKey | KTBXINOMWTXJKM-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.48 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|