C30H42O2 — CID 58803757
2-tert-butyl-6-[1-(3-tert-butyl-2-hydroxy-5-methylphenyl)-2-prop-2-enylpent-4-enyl]-4-methylphenol (PubChem CID 58803757) has the molecular formula C30H42O2 and a molecular weight of 434.66 g/mol. Its IUPAC name is 2-tert-butyl-6-[1-(3-tert-butyl-2-hydroxy-5-methylphenyl)-2-prop-2-enylpent-4-enyl]-4-methylphenol.
| Compound Name | 2-tert-butyl-6-[1-(3-tert-butyl-2-hydroxy-5-methylphenyl)-2-prop-2-enylpent-4-enyl]-4-methylphenol |
|---|---|
| PubChem CID | 58803757 |
| Molecular Formula | C30H42O2 |
| Molecular Weight | 434.66 g/mol |
| Exact Mass | 434.32 |
| IUPAC Name | 2-tert-butyl-6-[1-(3-tert-butyl-2-hydroxy-5-methylphenyl)-2-prop-2-enylpent-4-enyl]-4-methylphenol |
| SMILES | C=CCC(CC=C)C(c1cc(C)cc(C(C)(C)C)c1O)c1cc(C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C30H42O2/c1-11-13-21(14-12-2)26(22-15-19(3)17-24(27(22)31)29(5,6)7)23-16-20(4)18-25(28(23)32)30(8,9)10/h11-12,15-18,21,26,31-32H,1-2,13-14H2,3-10H3 |
| InChIKey | LCWAJUZGPMQXMB-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.66 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|