C52H76O4 — CID 162123967
2-tert-butyl-4-[1-(5-tert-butyl-4-hydroxy-2-methylphenyl)butyl]-5-methylphenol (PubChem CID 162123967) has the molecular formula C52H76O4 and a molecular weight of 765.18 g/mol. Its IUPAC name is 2-tert-butyl-4-[1-(5-tert-butyl-4-hydroxy-2-methylphenyl)butyl]-5-methylphenol.
| Compound Name | 2-tert-butyl-4-[1-(5-tert-butyl-4-hydroxy-2-methylphenyl)butyl]-5-methylphenol |
|---|---|
| PubChem CID | 162123967 |
| Molecular Formula | C52H76O4 |
| Molecular Weight | 765.18 g/mol |
| Exact Mass | 764.57 |
| IUPAC Name | 2-tert-butyl-4-[1-(5-tert-butyl-4-hydroxy-2-methylphenyl)butyl]-5-methylphenol |
| SMILES | CCCC(c1cc(C(C)(C)C)c(O)cc1C)c1cc(C(C)(C)C)c(O)cc1C.CCCC(c1cc(C(C)(C)C)c(O)cc1C)c1cc(C(C)(C)C)c(O)cc1C |
| InChI | InChI=1S/2C26H38O2/c2*1-10-11-18(19-14-21(25(4,5)6)23(27)12-16(19)2)20-15-22(26(7,8)9)24(28)13-17(20)3/h2*12-15,18,27-28H,10-11H2,1-9H3 |
| InChIKey | ZHTYTBCJTNMRHK-UHFFFAOYSA-N |
| XLogP | 14.48 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.18 |
| LogP ≤ 5 | 14.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |