C27H37NaO4 — CID 20829570
sodium 5,5-bis(5-tert-butyl-4-hydroxy-2-methylphenyl)pentanoate (PubChem CID 20829570) has the molecular formula C27H37NaO4 and a molecular weight of 448.58 g/mol. Its IUPAC name is sodium 5,5-bis(5-tert-butyl-4-hydroxy-2-methylphenyl)pentanoate.
| Compound Name | sodium 5,5-bis(5-tert-butyl-4-hydroxy-2-methylphenyl)pentanoate |
|---|---|
| PubChem CID | 20829570 |
| Molecular Formula | C27H37NaO4 |
| Molecular Weight | 448.58 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | sodium 5,5-bis(5-tert-butyl-4-hydroxy-2-methylphenyl)pentanoate |
| SMILES | Cc1cc(O)c(C(C)(C)C)cc1C(CCCC(=O)[O-])c1cc(C(C)(C)C)c(O)cc1C.[Na+] |
| InChI | InChI=1S/C27H38O4.Na/c1-16-12-23(28)21(26(3,4)5)14-19(16)18(10-9-11-25(30)31)20-15-22(27(6,7)8)24(29)13-17(20)2;/h12-15,18,28-29H,9-11H2,1-8H3,(H,30,31);/q;+1/p-1 |
| InChIKey | CCVCLMSMYIVJMU-UHFFFAOYSA-M |
| XLogP | 2.37 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.58 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |