C33H44N2O2S — CID 162197740
2-tert-butyl-4-[1-(5-tert-butyl-4-hydroxy-2-methylphenyl)butyl]-5-methylphenol;1,3-dihydrobenzimidazole-2-thione (PubChem CID 162197740) has the molecular formula C33H44N2O2S and a molecular weight of 532.79 g/mol. Its IUPAC name is 2-tert-butyl-4-[1-(5-tert-butyl-4-hydroxy-2-methylphenyl)butyl]-5-methylphenol;1,3-dihydrobenzimidazole-2-thione.
| Compound Name | 2-tert-butyl-4-[1-(5-tert-butyl-4-hydroxy-2-methylphenyl)butyl]-5-methylphenol;1,3-dihydrobenzimidazole-2-thione |
|---|---|
| PubChem CID | 162197740 |
| Molecular Formula | C33H44N2O2S |
| Molecular Weight | 532.79 g/mol |
| Exact Mass | 532.31 |
| IUPAC Name | 2-tert-butyl-4-[1-(5-tert-butyl-4-hydroxy-2-methylphenyl)butyl]-5-methylphenol;1,3-dihydrobenzimidazole-2-thione |
| SMILES | CCCC(c1cc(C(C)(C)C)c(O)cc1C)c1cc(C(C)(C)C)c(O)cc1C.S=c1[nH]c2ccccc2[nH]1 |
| InChI | InChI=1S/C26H38O2.C7H6N2S/c1-10-11-18(19-14-21(25(4,5)6)23(27)12-16(19)2)20-15-22(26(7,8)9)24(28)13-17(20)3;10-7-8-5-3-1-2-4-6(5)9-7/h12-15,18,27-28H,10-11H2,1-9H3;1-4H,(H2,8,9,10) |
| InChIKey | ZRECQWIQILJXKO-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 72.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.79 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|