C40H58O3 — CID 174857958
4-[4,4-bis(5-tert-butyl-4-hydroxy-2-methylphenyl)butan-2-yl]-2-tert-butyl-5-methylphenol;prop-1-ene (PubChem CID 174857958) has the molecular formula C40H58O3 and a molecular weight of 586.90 g/mol. Its IUPAC name is 4-[4,4-bis(5-tert-butyl-4-hydroxy-2-methylphenyl)butan-2-yl]-2-tert-butyl-5-methylphenol;prop-1-ene.
| Compound Name | 4-[4,4-bis(5-tert-butyl-4-hydroxy-2-methylphenyl)butan-2-yl]-2-tert-butyl-5-methylphenol;prop-1-ene |
|---|---|
| PubChem CID | 174857958 |
| Molecular Formula | C40H58O3 |
| Molecular Weight | 586.90 g/mol |
| Exact Mass | 586.44 |
| IUPAC Name | 4-[4,4-bis(5-tert-butyl-4-hydroxy-2-methylphenyl)butan-2-yl]-2-tert-butyl-5-methylphenol;prop-1-ene |
| SMILES | C=CC.Cc1cc(O)c(C(C)(C)C)cc1C(C)CC(c1cc(C(C)(C)C)c(O)cc1C)c1cc(C(C)(C)C)c(O)cc1C |
| InChI | InChI=1S/C37H52O3.C3H6/c1-21(25-18-29(35(5,6)7)32(38)15-22(25)2)14-28(26-19-30(36(8,9)10)33(39)16-23(26)3)27-20-31(37(11,12)13)34(40)17-24(27)4;1-3-2/h15-21,28,38-40H,14H2,1-13H3;3H,1H2,2H3 |
| InChIKey | DIGQCZPHMWOQQP-UHFFFAOYSA-N |
| XLogP | 11.14 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.90 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|